C14H13F2NO — CID 64831592
1-(2-aminophenyl)-2-(2,5-difluorophenyl)ethanol (PubChem CID 64831592) has the molecular formula C14H13F2NO and a molecular weight of 249.26 g/mol. Its IUPAC name is 1-(2-aminophenyl)-2-(2,5-difluorophenyl)ethanol.
| Compound Name | 1-(2-aminophenyl)-2-(2,5-difluorophenyl)ethanol |
|---|---|
| PubChem CID | 64831592 |
| Molecular Formula | C14H13F2NO |
| Molecular Weight | 249.26 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 1-(2-aminophenyl)-2-(2,5-difluorophenyl)ethanol |
| SMILES | Nc1ccccc1C(O)Cc1cc(F)ccc1F |
| InChI | InChI=1S/C14H13F2NO/c15-10-5-6-12(16)9(7-10)8-14(18)11-3-1-2-4-13(11)17/h1-7,14,18H,8,17H2 |
| InChIKey | XDXOAMORSMVDDC-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.26 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|