C18H14F2O — CID 62716910
2-(2,5-difluorophenyl)-1-naphthalen-2-ylethanol (PubChem CID 62716910) has the molecular formula C18H14F2O and a molecular weight of 284.31 g/mol. Its IUPAC name is 2-(2,5-difluorophenyl)-1-naphthalen-2-ylethanol.
| Compound Name | 2-(2,5-difluorophenyl)-1-naphthalen-2-ylethanol |
|---|---|
| PubChem CID | 62716910 |
| Molecular Formula | C18H14F2O |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 2-(2,5-difluorophenyl)-1-naphthalen-2-ylethanol |
| SMILES | OC(Cc1cc(F)ccc1F)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C18H14F2O/c19-16-7-8-17(20)15(10-16)11-18(21)14-6-5-12-3-1-2-4-13(12)9-14/h1-10,18,21H,11H2 |
| InChIKey | BTFULZVHYWYFJB-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |