C15H12F4O2 — CID 63893268
1-[4-(difluoromethoxy)phenyl]-2-(2,5-difluorophenyl)ethanol (PubChem CID 63893268) has the molecular formula C15H12F4O2 and a molecular weight of 300.25 g/mol. Its IUPAC name is 1-[4-(difluoromethoxy)phenyl]-2-(2,5-difluorophenyl)ethanol.
| Compound Name | 1-[4-(difluoromethoxy)phenyl]-2-(2,5-difluorophenyl)ethanol |
|---|---|
| PubChem CID | 63893268 |
| Molecular Formula | C15H12F4O2 |
| Molecular Weight | 300.25 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 1-[4-(difluoromethoxy)phenyl]-2-(2,5-difluorophenyl)ethanol |
| SMILES | OC(Cc1cc(F)ccc1F)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C15H12F4O2/c16-11-3-6-13(17)10(7-11)8-14(20)9-1-4-12(5-2-9)21-15(18)19/h1-7,14-15,20H,8H2 |
| InChIKey | QCTTZSANTNFJAF-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.25 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |