C11H11FN2OS — CID 82685101
1-(2-amino-5-fluorophenyl)-2-(1,3-thiazol-2-yl)ethanol (PubChem CID 82685101) has the molecular formula C11H11FN2OS and a molecular weight of 238.29 g/mol. Its IUPAC name is 1-(2-amino-5-fluorophenyl)-2-(1,3-thiazol-2-yl)ethanol.
| Compound Name | 1-(2-amino-5-fluorophenyl)-2-(1,3-thiazol-2-yl)ethanol |
|---|---|
| PubChem CID | 82685101 |
| Molecular Formula | C11H11FN2OS |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 1-(2-amino-5-fluorophenyl)-2-(1,3-thiazol-2-yl)ethanol |
| SMILES | Nc1ccc(F)cc1C(O)Cc1nccs1 |
| InChI | InChI=1S/C11H11FN2OS/c12-7-1-2-9(13)8(5-7)10(15)6-11-14-3-4-16-11/h1-5,10,15H,6,13H2 |
| InChIKey | YSNWWQDYDZLEEK-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|