About 1-(2-amino-5-fluorophenyl)-2-(1,3-thiazol-2-yl)ethanol
1-(2-amino-5-fluorophenyl)-2-(1,3-thiazol-2-yl)ethanol (PubChem CID 82685101) has the molecular formula C11H11FN2OS
and a molecular weight of 238.29 g/mol. Its IUPAC name is 1-(2-amino-5-fluorophenyl)-2-(1,3-thiazol-2-yl)ethanol.
Molecular Properties
| Compound Name | 1-(2-amino-5-fluorophenyl)-2-(1,3-thiazol-2-yl)ethanol |
| PubChem CID | 82685101 |
| Molecular Formula | C11H11FN2OS |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 1-(2-amino-5-fluorophenyl)-2-(1,3-thiazol-2-yl)ethanol |
| SMILES | Nc1ccc(F)cc1C(O)Cc1nccs1 |
| InChI | InChI=1S/C11H11FN2OS/c12-7-1-2-9(13)8(5-7)10(15)6-11-14-3-4-16-11/h1-5,10,15H,6,13H2 |
| InChIKey | YSNWWQDYDZLEEK-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-amino-5-fluorophenyl)-2-(1,3-thiazol-2-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-amino-5-fluorophenyl)-2-(1,3-thiazol-2-yl)ethanol?
The IUPAC name of 1-(2-amino-5-fluorophenyl)-2-(1,3-thiazol-2-yl)ethanol (CID 82685101) is 1-(2-amino-5-fluorophenyl)-2-(1,3-thiazol-2-yl)ethanol.
What is the SMILES notation for 1-(2-amino-5-fluorophenyl)-2-(1,3-thiazol-2-yl)ethanol?
The canonical SMILES for 1-(2-amino-5-fluorophenyl)-2-(1,3-thiazol-2-yl)ethanol is Nc1ccc(F)cc1C(O)Cc1nccs1.
What is the InChIKey of 1-(2-amino-5-fluorophenyl)-2-(1,3-thiazol-2-yl)ethanol?
The InChIKey is YSNWWQDYDZLEEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11FN2OS/c12-7-1-2-9(13)8(5-7)10(15)6-11-14-3-4-16-11/h1-5,10,15H,6,13H2.
What are the key properties of 1-(2-amino-5-fluorophenyl)-2-(1,3-thiazol-2-yl)ethanol?
1-(2-amino-5-fluorophenyl)-2-(1,3-thiazol-2-yl)ethanol has a molecular weight of 238.29 g/mol, XLogP of 2.14, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-amino-5-fluorophenyl)-2-(1,3-thiazol-2-yl)ethanol is sourced from PubChem (CID 82685101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).