C9H8ClNOS2 — CID 115822545
1-(3-chlorothiophen-2-yl)-2-(1,3-thiazol-2-yl)ethanol (PubChem CID 115822545) has the molecular formula C9H8ClNOS2 and a molecular weight of 245.76 g/mol. Its IUPAC name is 1-(3-chlorothiophen-2-yl)-2-(1,3-thiazol-2-yl)ethanol.
| Compound Name | 1-(3-chlorothiophen-2-yl)-2-(1,3-thiazol-2-yl)ethanol |
|---|---|
| PubChem CID | 115822545 |
| Molecular Formula | C9H8ClNOS2 |
| Molecular Weight | 245.76 g/mol |
| Exact Mass | 244.97 |
| IUPAC Name | 1-(3-chlorothiophen-2-yl)-2-(1,3-thiazol-2-yl)ethanol |
| SMILES | OC(Cc1nccs1)c1sccc1Cl |
| InChI | InChI=1S/C9H8ClNOS2/c10-6-1-3-14-9(6)7(12)5-8-11-2-4-13-8/h1-4,7,12H,5H2 |
| InChIKey | WLFXCLZYVZXCGA-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.76 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |