C14H15ClOS — CID 115828463
1-(3-chlorothiophen-2-yl)-2-(2,6-dimethylphenyl)ethanol (PubChem CID 115828463) has the molecular formula C14H15ClOS and a molecular weight of 266.79 g/mol. Its IUPAC name is 1-(3-chlorothiophen-2-yl)-2-(2,6-dimethylphenyl)ethanol.
| Compound Name | 1-(3-chlorothiophen-2-yl)-2-(2,6-dimethylphenyl)ethanol |
|---|---|
| PubChem CID | 115828463 |
| Molecular Formula | C14H15ClOS |
| Molecular Weight | 266.79 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | 1-(3-chlorothiophen-2-yl)-2-(2,6-dimethylphenyl)ethanol |
| SMILES | Cc1cccc(C)c1CC(O)c1sccc1Cl |
| InChI | InChI=1S/C14H15ClOS/c1-9-4-3-5-10(2)11(9)8-13(16)14-12(15)6-7-17-14/h3-7,13,16H,8H2,1-2H3 |
| InChIKey | FNQSNTWNXWBXEA-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.79 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |