C12H9ClF2OS — CID 114982062
1-(3-chlorothiophen-2-yl)-2-(2,5-difluorophenyl)ethanol (PubChem CID 114982062) has the molecular formula C12H9ClF2OS and a molecular weight of 274.72 g/mol. Its IUPAC name is 1-(3-chlorothiophen-2-yl)-2-(2,5-difluorophenyl)ethanol.
| Compound Name | 1-(3-chlorothiophen-2-yl)-2-(2,5-difluorophenyl)ethanol |
|---|---|
| PubChem CID | 114982062 |
| Molecular Formula | C12H9ClF2OS |
| Molecular Weight | 274.72 g/mol |
| Exact Mass | 274.00 |
| IUPAC Name | 1-(3-chlorothiophen-2-yl)-2-(2,5-difluorophenyl)ethanol |
| SMILES | OC(Cc1cc(F)ccc1F)c1sccc1Cl |
| InChI | InChI=1S/C12H9ClF2OS/c13-9-3-4-17-12(9)11(16)6-7-5-8(14)1-2-10(7)15/h1-5,11,16H,6H2 |
| InChIKey | ISQUINDOUSZHJH-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.72 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |