C14H19FN4O — CID 82685783
1-(2-amino-5-fluorophenyl)-2-[2-(2-methylpropyl)-1,2,4-triazol-3-yl]ethanol (PubChem CID 82685783) has the molecular formula C14H19FN4O and a molecular weight of 278.33 g/mol. Its IUPAC name is 1-(2-amino-5-fluorophenyl)-2-[2-(2-methylpropyl)-1,2,4-triazol-3-yl]ethanol.
| Compound Name | 1-(2-amino-5-fluorophenyl)-2-[2-(2-methylpropyl)-1,2,4-triazol-3-yl]ethanol |
|---|---|
| PubChem CID | 82685783 |
| Molecular Formula | C14H19FN4O |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 1-(2-amino-5-fluorophenyl)-2-[2-(2-methylpropyl)-1,2,4-triazol-3-yl]ethanol |
| SMILES | CC(C)Cn1ncnc1CC(O)c1cc(F)ccc1N |
| InChI | InChI=1S/C14H19FN4O/c1-9(2)7-19-14(17-8-18-19)6-13(20)11-5-10(15)3-4-12(11)16/h3-5,8-9,13,20H,6-7,16H2,1-2H3 |
| InChIKey | RFPPJXIIKGZHHV-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|