C11H9F2NOS — CID 79823901
1-(3,5-difluorophenyl)-2-(1,3-thiazol-2-yl)ethanol (PubChem CID 79823901) has the molecular formula C11H9F2NOS and a molecular weight of 241.26 g/mol. Its IUPAC name is 1-(3,5-difluorophenyl)-2-(1,3-thiazol-2-yl)ethanol.
| Compound Name | 1-(3,5-difluorophenyl)-2-(1,3-thiazol-2-yl)ethanol |
|---|---|
| PubChem CID | 79823901 |
| Molecular Formula | C11H9F2NOS |
| Molecular Weight | 241.26 g/mol |
| Exact Mass | 241.04 |
| IUPAC Name | 1-(3,5-difluorophenyl)-2-(1,3-thiazol-2-yl)ethanol |
| SMILES | OC(Cc1nccs1)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C11H9F2NOS/c12-8-3-7(4-9(13)5-8)10(15)6-11-14-1-2-16-11/h1-5,10,15H,6H2 |
| InChIKey | NQWOKSKAFJOOFO-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.26 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |