C11H12N2OS — CID 106756289
1-(2-methyl-4-pyridinyl)-2-(1,3-thiazol-2-yl)ethanol (PubChem CID 106756289) has the molecular formula C11H12N2OS and a molecular weight of 220.30 g/mol. Its IUPAC name is 1-(2-methyl-4-pyridinyl)-2-(1,3-thiazol-2-yl)ethanol.
| Compound Name | 1-(2-methyl-4-pyridinyl)-2-(1,3-thiazol-2-yl)ethanol |
|---|---|
| PubChem CID | 106756289 |
| Molecular Formula | C11H12N2OS |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | 1-(2-methyl-4-pyridinyl)-2-(1,3-thiazol-2-yl)ethanol |
| SMILES | Cc1cc(C(O)Cc2nccs2)ccn1 |
| InChI | InChI=1S/C11H12N2OS/c1-8-6-9(2-3-12-8)10(14)7-11-13-4-5-15-11/h2-6,10,14H,7H2,1H3 |
| InChIKey | GCWKNJPIWPBWJY-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |