C13H15NO2S — CID 79823661
1-[3-(methoxymethyl)phenyl]-2-(1,3-thiazol-2-yl)ethanol (PubChem CID 79823661) has the molecular formula C13H15NO2S and a molecular weight of 249.34 g/mol. Its IUPAC name is 1-[3-(methoxymethyl)phenyl]-2-(1,3-thiazol-2-yl)ethanol.
| Compound Name | 1-[3-(methoxymethyl)phenyl]-2-(1,3-thiazol-2-yl)ethanol |
|---|---|
| PubChem CID | 79823661 |
| Molecular Formula | C13H15NO2S |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | 1-[3-(methoxymethyl)phenyl]-2-(1,3-thiazol-2-yl)ethanol |
| SMILES | COCc1cccc(C(O)Cc2nccs2)c1 |
| InChI | InChI=1S/C13H15NO2S/c1-16-9-10-3-2-4-11(7-10)12(15)8-13-14-5-6-17-13/h2-7,12,15H,8-9H2,1H3 |
| InChIKey | BZDQCMAMMFRBPH-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |