C11H12N2O2S — CID 105115288
1-(2-methoxy-3-pyridinyl)-2-(1,3-thiazol-2-yl)ethanol (PubChem CID 105115288) has the molecular formula C11H12N2O2S and a molecular weight of 236.30 g/mol. Its IUPAC name is 1-(2-methoxy-3-pyridinyl)-2-(1,3-thiazol-2-yl)ethanol.
| Compound Name | 1-(2-methoxy-3-pyridinyl)-2-(1,3-thiazol-2-yl)ethanol |
|---|---|
| PubChem CID | 105115288 |
| Molecular Formula | C11H12N2O2S |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | 1-(2-methoxy-3-pyridinyl)-2-(1,3-thiazol-2-yl)ethanol |
| SMILES | COc1ncccc1C(O)Cc1nccs1 |
| InChI | InChI=1S/C11H12N2O2S/c1-15-11-8(3-2-4-13-11)9(14)7-10-12-5-6-16-10/h2-6,9,14H,7H2,1H3 |
| InChIKey | GIMXCMDFWWGUPA-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |