C10H11N3O2S — CID 103373619
1-(6-methoxypyridazin-3-yl)-2-(1,3-thiazol-2-yl)ethanol (PubChem CID 103373619) has the molecular formula C10H11N3O2S and a molecular weight of 237.28 g/mol. Its IUPAC name is 1-(6-methoxypyridazin-3-yl)-2-(1,3-thiazol-2-yl)ethanol.
| Compound Name | 1-(6-methoxypyridazin-3-yl)-2-(1,3-thiazol-2-yl)ethanol |
|---|---|
| PubChem CID | 103373619 |
| Molecular Formula | C10H11N3O2S |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | 1-(6-methoxypyridazin-3-yl)-2-(1,3-thiazol-2-yl)ethanol |
| SMILES | COc1ccc(C(O)Cc2nccs2)nn1 |
| InChI | InChI=1S/C10H11N3O2S/c1-15-9-3-2-7(12-13-9)8(14)6-10-11-4-5-16-10/h2-5,8,14H,6H2,1H3 |
| InChIKey | FSAKQMNXHRZWRM-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 68.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |