C14H17NO4S — CID 79823539
2-(1,3-thiazol-2-yl)-1-(2,3,4-trimethoxyphenyl)ethanol (PubChem CID 79823539) has the molecular formula C14H17NO4S and a molecular weight of 295.36 g/mol. Its IUPAC name is 2-(1,3-thiazol-2-yl)-1-(2,3,4-trimethoxyphenyl)ethanol.
| Compound Name | 2-(1,3-thiazol-2-yl)-1-(2,3,4-trimethoxyphenyl)ethanol |
|---|---|
| PubChem CID | 79823539 |
| Molecular Formula | C14H17NO4S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | 2-(1,3-thiazol-2-yl)-1-(2,3,4-trimethoxyphenyl)ethanol |
| SMILES | COc1ccc(C(O)Cc2nccs2)c(OC)c1OC |
| InChI | InChI=1S/C14H17NO4S/c1-17-11-5-4-9(13(18-2)14(11)19-3)10(16)8-12-15-6-7-20-12/h4-7,10,16H,8H2,1-3H3 |
| InChIKey | CQLSPQYUQGAFPZ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 60.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |