C12H13NO2S — CID 79823536
1-(3-methoxyphenyl)-2-(1,3-thiazol-2-yl)ethanol (PubChem CID 79823536) has the molecular formula C12H13NO2S and a molecular weight of 235.31 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-2-(1,3-thiazol-2-yl)ethanol.
| Compound Name | 1-(3-methoxyphenyl)-2-(1,3-thiazol-2-yl)ethanol |
|---|---|
| PubChem CID | 79823536 |
| Molecular Formula | C12H13NO2S |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | 1-(3-methoxyphenyl)-2-(1,3-thiazol-2-yl)ethanol |
| SMILES | COc1cccc(C(O)Cc2nccs2)c1 |
| InChI | InChI=1S/C12H13NO2S/c1-15-10-4-2-3-9(7-10)11(14)8-12-13-5-6-16-12/h2-7,11,14H,8H2,1H3 |
| InChIKey | NAPMEMWVUNRNNU-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |