C14H14O5S — CID 81134733
3-[2-hydroxy-2-(3-methoxyphenyl)ethoxy]thiophene-2-carboxylic acid (PubChem CID 81134733) has the molecular formula C14H14O5S and a molecular weight of 294.33 g/mol. Its IUPAC name is 3-[2-hydroxy-2-(3-methoxyphenyl)ethoxy]thiophene-2-carboxylic acid.
| Compound Name | 3-[2-hydroxy-2-(3-methoxyphenyl)ethoxy]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 81134733 |
| Molecular Formula | C14H14O5S |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | 3-[2-hydroxy-2-(3-methoxyphenyl)ethoxy]thiophene-2-carboxylic acid |
| SMILES | COc1cccc(C(O)COc2ccsc2C(=O)O)c1 |
| InChI | InChI=1S/C14H14O5S/c1-18-10-4-2-3-9(7-10)11(15)8-19-12-5-6-20-13(12)14(16)17/h2-7,11,15H,8H2,1H3,(H,16,17) |
| InChIKey | CZBDNNMVWDGDDS-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |