C18H22O4 — CID 110907759
1-(3-methoxyphenyl)-2-(2-propoxyphenoxy)ethanol (PubChem CID 110907759) has the molecular formula C18H22O4 and a molecular weight of 302.37 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-2-(2-propoxyphenoxy)ethanol.
| Compound Name | 1-(3-methoxyphenyl)-2-(2-propoxyphenoxy)ethanol |
|---|---|
| PubChem CID | 110907759 |
| Molecular Formula | C18H22O4 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 1-(3-methoxyphenyl)-2-(2-propoxyphenoxy)ethanol |
| SMILES | CCCOc1ccccc1OCC(O)c1cccc(OC)c1 |
| InChI | InChI=1S/C18H22O4/c1-3-11-21-17-9-4-5-10-18(17)22-13-16(19)14-7-6-8-15(12-14)20-2/h4-10,12,16,19H,3,11,13H2,1-2H3 |
| InChIKey | BHMOYMORHXALBQ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |