C16H14BrCl3O — CID 63434482
4-bromo-2-[1-chloro-2-(3,4-dichlorophenyl)ethyl]-1-ethoxybenzene (PubChem CID 63434482) has the molecular formula C16H14BrCl3O and a molecular weight of 408.55 g/mol. Its IUPAC name is 4-bromo-2-[1-chloro-2-(3,4-dichlorophenyl)ethyl]-1-ethoxybenzene.
| Compound Name | 4-bromo-2-[1-chloro-2-(3,4-dichlorophenyl)ethyl]-1-ethoxybenzene |
|---|---|
| PubChem CID | 63434482 |
| Molecular Formula | C16H14BrCl3O |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 405.93 |
| IUPAC Name | 4-bromo-2-[1-chloro-2-(3,4-dichlorophenyl)ethyl]-1-ethoxybenzene |
| SMILES | CCOc1ccc(Br)cc1C(Cl)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H14BrCl3O/c1-2-21-16-6-4-11(17)9-12(16)14(19)7-10-3-5-13(18)15(20)8-10/h3-6,8-9,14H,2,7H2,1H3 |
| InChIKey | ROISHLKJHCBULJ-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|