C14H20BrClO — CID 55200436
4-bromo-2-(1-chloro-3,3-dimethylbutyl)-1-ethoxybenzene (PubChem CID 55200436) has the molecular formula C14H20BrClO and a molecular weight of 319.67 g/mol. Its IUPAC name is 4-bromo-2-(1-chloro-3,3-dimethylbutyl)-1-ethoxybenzene.
| Compound Name | 4-bromo-2-(1-chloro-3,3-dimethylbutyl)-1-ethoxybenzene |
|---|---|
| PubChem CID | 55200436 |
| Molecular Formula | C14H20BrClO |
| Molecular Weight | 319.67 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | 4-bromo-2-(1-chloro-3,3-dimethylbutyl)-1-ethoxybenzene |
| SMILES | CCOc1ccc(Br)cc1C(Cl)CC(C)(C)C |
| InChI | InChI=1S/C14H20BrClO/c1-5-17-13-7-6-10(15)8-11(13)12(16)9-14(2,3)4/h6-8,12H,5,9H2,1-4H3 |
| InChIKey | WGDIMMPPPZDALZ-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.67 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|