C14H16Cl2N4 — CID 105210921
3-[3-(3,4-dichlorophenyl)-2-hydrazinylpropyl]pyridin-2-amine (PubChem CID 105210921) has the molecular formula C14H16Cl2N4 and a molecular weight of 311.22 g/mol. Its IUPAC name is 3-[3-(3,4-dichlorophenyl)-2-hydrazinylpropyl]pyridin-2-amine.
| Compound Name | 3-[3-(3,4-dichlorophenyl)-2-hydrazinylpropyl]pyridin-2-amine |
|---|---|
| PubChem CID | 105210921 |
| Molecular Formula | C14H16Cl2N4 |
| Molecular Weight | 311.22 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 3-[3-(3,4-dichlorophenyl)-2-hydrazinylpropyl]pyridin-2-amine |
| SMILES | NNC(Cc1ccc(Cl)c(Cl)c1)Cc1cccnc1N |
| InChI | InChI=1S/C14H16Cl2N4/c15-12-4-3-9(7-13(12)16)6-11(20-18)8-10-2-1-5-19-14(10)17/h1-5,7,11,20H,6,8,18H2,(H2,17,19) |
| InChIKey | JUFZTFVIHOAEQU-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.22 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|