C14H17ClN4S — CID 105237744
3-[3-(2-chlorophenyl)sulfanyl-2-hydrazinylpropyl]pyridin-2-amine (PubChem CID 105237744) has the molecular formula C14H17ClN4S and a molecular weight of 308.84 g/mol. Its IUPAC name is 3-[3-(2-chlorophenyl)sulfanyl-2-hydrazinylpropyl]pyridin-2-amine.
| Compound Name | 3-[3-(2-chlorophenyl)sulfanyl-2-hydrazinylpropyl]pyridin-2-amine |
|---|---|
| PubChem CID | 105237744 |
| Molecular Formula | C14H17ClN4S |
| Molecular Weight | 308.84 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 3-[3-(2-chlorophenyl)sulfanyl-2-hydrazinylpropyl]pyridin-2-amine |
| SMILES | NNC(CSc1ccccc1Cl)Cc1cccnc1N |
| InChI | InChI=1S/C14H17ClN4S/c15-12-5-1-2-6-13(12)20-9-11(19-17)8-10-4-3-7-18-14(10)16/h1-7,11,19H,8-9,17H2,(H2,16,18) |
| InChIKey | BCSKYQJXZJPPJJ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.84 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|