C12H13ClN4 — CID 103443859
3-[2-amino-2-(3-chloro-2-pyridinyl)ethyl]pyridin-2-amine (PubChem CID 103443859) has the molecular formula C12H13ClN4 and a molecular weight of 248.72 g/mol. Its IUPAC name is 3-[2-amino-2-(3-chloro-2-pyridinyl)ethyl]pyridin-2-amine.
| Compound Name | 3-[2-amino-2-(3-chloro-2-pyridinyl)ethyl]pyridin-2-amine |
|---|---|
| PubChem CID | 103443859 |
| Molecular Formula | C12H13ClN4 |
| Molecular Weight | 248.72 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 3-[2-amino-2-(3-chloro-2-pyridinyl)ethyl]pyridin-2-amine |
| SMILES | Nc1ncccc1CC(N)c1ncccc1Cl |
| InChI | InChI=1S/C12H13ClN4/c13-9-4-2-5-16-11(9)10(14)7-8-3-1-6-17-12(8)15/h1-6,10H,7,14H2,(H2,15,17) |
| InChIKey | YOSLLXDPARGKNK-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.72 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |