C15H15Cl3N2S — CID 105237715
[1-(2-chlorophenyl)sulfanyl-3-(2,4-dichlorophenyl)propan-2-yl]hydrazine (PubChem CID 105237715) has the molecular formula C15H15Cl3N2S and a molecular weight of 361.73 g/mol. Its IUPAC name is [1-(2-chlorophenyl)sulfanyl-3-(2,4-dichlorophenyl)propan-2-yl]hydrazine.
| Compound Name | [1-(2-chlorophenyl)sulfanyl-3-(2,4-dichlorophenyl)propan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105237715 |
| Molecular Formula | C15H15Cl3N2S |
| Molecular Weight | 361.73 g/mol |
| Exact Mass | 360.00 |
| IUPAC Name | [1-(2-chlorophenyl)sulfanyl-3-(2,4-dichlorophenyl)propan-2-yl]hydrazine |
| SMILES | NNC(CSc1ccccc1Cl)Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H15Cl3N2S/c16-11-6-5-10(14(18)8-11)7-12(20-19)9-21-15-4-2-1-3-13(15)17/h1-6,8,12,20H,7,9,19H2 |
| InChIKey | AKWFYXUWJZTXJK-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.73 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|