C12H8Br2Cl2OS — CID 63426686
1-(2,5-dibromothiophen-3-yl)-2-(3,4-dichlorophenyl)ethanol (PubChem CID 63426686) has the molecular formula C12H8Br2Cl2OS and a molecular weight of 430.98 g/mol. Its IUPAC name is 1-(2,5-dibromothiophen-3-yl)-2-(3,4-dichlorophenyl)ethanol.
| Compound Name | 1-(2,5-dibromothiophen-3-yl)-2-(3,4-dichlorophenyl)ethanol |
|---|---|
| PubChem CID | 63426686 |
| Molecular Formula | C12H8Br2Cl2OS |
| Molecular Weight | 430.98 g/mol |
| Exact Mass | 427.80 |
| IUPAC Name | 1-(2,5-dibromothiophen-3-yl)-2-(3,4-dichlorophenyl)ethanol |
| SMILES | OC(Cc1ccc(Cl)c(Cl)c1)c1cc(Br)sc1Br |
| InChI | InChI=1S/C12H8Br2Cl2OS/c13-11-5-7(12(14)18-11)10(17)4-6-1-2-8(15)9(16)3-6/h1-3,5,10,17H,4H2 |
| InChIKey | WDHAJQUIAGFXAI-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.98 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |