C12H11Br2NOS — CID 114021943
1-(2,5-dibromothiophen-3-yl)-2-(5-methyl-2-pyridinyl)ethanol (PubChem CID 114021943) has the molecular formula C12H11Br2NOS and a molecular weight of 377.10 g/mol. Its IUPAC name is 1-(2,5-dibromothiophen-3-yl)-2-(5-methyl-2-pyridinyl)ethanol.
| Compound Name | 1-(2,5-dibromothiophen-3-yl)-2-(5-methyl-2-pyridinyl)ethanol |
|---|---|
| PubChem CID | 114021943 |
| Molecular Formula | C12H11Br2NOS |
| Molecular Weight | 377.10 g/mol |
| Exact Mass | 374.89 |
| IUPAC Name | 1-(2,5-dibromothiophen-3-yl)-2-(5-methyl-2-pyridinyl)ethanol |
| SMILES | Cc1ccc(CC(O)c2cc(Br)sc2Br)nc1 |
| InChI | InChI=1S/C12H11Br2NOS/c1-7-2-3-8(15-6-7)4-10(16)9-5-11(13)17-12(9)14/h2-3,5-6,10,16H,4H2,1H3 |
| InChIKey | VVDRRHQGWOLBFJ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.10 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |