C11H8BrCl2NOS — CID 107969876
2-(5-bromo-2-pyridinyl)-1-(2,5-dichlorothiophen-3-yl)ethanol (PubChem CID 107969876) has the molecular formula C11H8BrCl2NOS and a molecular weight of 353.07 g/mol. Its IUPAC name is 2-(5-bromo-2-pyridinyl)-1-(2,5-dichlorothiophen-3-yl)ethanol.
| Compound Name | 2-(5-bromo-2-pyridinyl)-1-(2,5-dichlorothiophen-3-yl)ethanol |
|---|---|
| PubChem CID | 107969876 |
| Molecular Formula | C11H8BrCl2NOS |
| Molecular Weight | 353.07 g/mol |
| Exact Mass | 350.89 |
| IUPAC Name | 2-(5-bromo-2-pyridinyl)-1-(2,5-dichlorothiophen-3-yl)ethanol |
| SMILES | OC(Cc1ccc(Br)cn1)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C11H8BrCl2NOS/c12-6-1-2-7(15-5-6)3-9(16)8-4-10(13)17-11(8)14/h1-2,4-5,9,16H,3H2 |
| InChIKey | YLRSZIIGTJRSKL-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.07 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |