C13H10Br3NO — CID 107978662
2-(5-bromo-2-pyridinyl)-1-(3,5-dibromophenyl)ethanol (PubChem CID 107978662) has the molecular formula C13H10Br3NO and a molecular weight of 435.94 g/mol. Its IUPAC name is 2-(5-bromo-2-pyridinyl)-1-(3,5-dibromophenyl)ethanol.
| Compound Name | 2-(5-bromo-2-pyridinyl)-1-(3,5-dibromophenyl)ethanol |
|---|---|
| PubChem CID | 107978662 |
| Molecular Formula | C13H10Br3NO |
| Molecular Weight | 435.94 g/mol |
| Exact Mass | 432.83 |
| IUPAC Name | 2-(5-bromo-2-pyridinyl)-1-(3,5-dibromophenyl)ethanol |
| SMILES | OC(Cc1ccc(Br)cn1)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C13H10Br3NO/c14-9-1-2-12(17-7-9)6-13(18)8-3-10(15)5-11(16)4-8/h1-5,7,13,18H,6H2 |
| InChIKey | UGJVCHYZMWFCLC-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.94 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |