C9H8Cl2N2OS — CID 107964204
1-(2,5-dichlorothiophen-3-yl)-2-(1H-imidazol-2-yl)ethanol (PubChem CID 107964204) has the molecular formula C9H8Cl2N2OS and a molecular weight of 263.15 g/mol. Its IUPAC name is 1-(2,5-dichlorothiophen-3-yl)-2-(1H-imidazol-2-yl)ethanol.
| Compound Name | 1-(2,5-dichlorothiophen-3-yl)-2-(1H-imidazol-2-yl)ethanol |
|---|---|
| PubChem CID | 107964204 |
| Molecular Formula | C9H8Cl2N2OS |
| Molecular Weight | 263.15 g/mol |
| Exact Mass | 261.97 |
| IUPAC Name | 1-(2,5-dichlorothiophen-3-yl)-2-(1H-imidazol-2-yl)ethanol |
| SMILES | OC(Cc1ncc[nH]1)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C9H8Cl2N2OS/c10-7-3-5(9(11)15-7)6(14)4-8-12-1-2-13-8/h1-3,6,14H,4H2,(H,12,13) |
| InChIKey | QRZGNVILXPMDKD-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.15 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |