C12H9BrCl2OS — CID 55239745
1-(3-bromothiophen-2-yl)-2-(3,4-dichlorophenyl)ethanol (PubChem CID 55239745) has the molecular formula C12H9BrCl2OS and a molecular weight of 352.08 g/mol. Its IUPAC name is 1-(3-bromothiophen-2-yl)-2-(3,4-dichlorophenyl)ethanol.
| Compound Name | 1-(3-bromothiophen-2-yl)-2-(3,4-dichlorophenyl)ethanol |
|---|---|
| PubChem CID | 55239745 |
| Molecular Formula | C12H9BrCl2OS |
| Molecular Weight | 352.08 g/mol |
| Exact Mass | 349.89 |
| IUPAC Name | 1-(3-bromothiophen-2-yl)-2-(3,4-dichlorophenyl)ethanol |
| SMILES | OC(Cc1ccc(Cl)c(Cl)c1)c1sccc1Br |
| InChI | InChI=1S/C12H9BrCl2OS/c13-8-3-4-17-12(8)11(16)6-7-1-2-9(14)10(15)5-7/h1-5,11,16H,6H2 |
| InChIKey | NPQAJXCOTGZENS-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.08 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |