C14H9BrCl2F2O — CID 106941955
1-(3-bromo-2,6-difluorophenyl)-2-(3,4-dichlorophenyl)ethanol (PubChem CID 106941955) has the molecular formula C14H9BrCl2F2O and a molecular weight of 382.03 g/mol. Its IUPAC name is 1-(3-bromo-2,6-difluorophenyl)-2-(3,4-dichlorophenyl)ethanol.
| Compound Name | 1-(3-bromo-2,6-difluorophenyl)-2-(3,4-dichlorophenyl)ethanol |
|---|---|
| PubChem CID | 106941955 |
| Molecular Formula | C14H9BrCl2F2O |
| Molecular Weight | 382.03 g/mol |
| Exact Mass | 379.92 |
| IUPAC Name | 1-(3-bromo-2,6-difluorophenyl)-2-(3,4-dichlorophenyl)ethanol |
| SMILES | OC(Cc1ccc(Cl)c(Cl)c1)c1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C14H9BrCl2F2O/c15-8-2-4-11(18)13(14(8)19)12(20)6-7-1-3-9(16)10(17)5-7/h1-5,12,20H,6H2 |
| InChIKey | POMQSRAMLPPZMW-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.03 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|