C14H10Br2F2O — CID 106941936
1-(3-bromo-2,6-difluorophenyl)-2-(3-bromophenyl)ethanol (PubChem CID 106941936) has the molecular formula C14H10Br2F2O and a molecular weight of 392.04 g/mol. Its IUPAC name is 1-(3-bromo-2,6-difluorophenyl)-2-(3-bromophenyl)ethanol.
| Compound Name | 1-(3-bromo-2,6-difluorophenyl)-2-(3-bromophenyl)ethanol |
|---|---|
| PubChem CID | 106941936 |
| Molecular Formula | C14H10Br2F2O |
| Molecular Weight | 392.04 g/mol |
| Exact Mass | 389.91 |
| IUPAC Name | 1-(3-bromo-2,6-difluorophenyl)-2-(3-bromophenyl)ethanol |
| SMILES | OC(Cc1cccc(Br)c1)c1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C14H10Br2F2O/c15-9-3-1-2-8(6-9)7-12(19)13-11(17)5-4-10(16)14(13)18/h1-6,12,19H,7H2 |
| InChIKey | ITMWDBKEPBMWPA-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.04 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|