C15H11BrCl2F2O — CID 106266420
1-(3-bromo-2,6-difluorophenyl)-3-(3,4-dichlorophenyl)propan-2-ol (PubChem CID 106266420) has the molecular formula C15H11BrCl2F2O and a molecular weight of 396.06 g/mol. Its IUPAC name is 1-(3-bromo-2,6-difluorophenyl)-3-(3,4-dichlorophenyl)propan-2-ol.
| Compound Name | 1-(3-bromo-2,6-difluorophenyl)-3-(3,4-dichlorophenyl)propan-2-ol |
|---|---|
| PubChem CID | 106266420 |
| Molecular Formula | C15H11BrCl2F2O |
| Molecular Weight | 396.06 g/mol |
| Exact Mass | 393.93 |
| IUPAC Name | 1-(3-bromo-2,6-difluorophenyl)-3-(3,4-dichlorophenyl)propan-2-ol |
| SMILES | OC(Cc1ccc(Cl)c(Cl)c1)Cc1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C15H11BrCl2F2O/c16-11-2-4-14(19)10(15(11)20)7-9(21)5-8-1-3-12(17)13(18)6-8/h1-4,6,9,21H,5,7H2 |
| InChIKey | GBLMNMYLJAHNKT-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.06 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|