C14H9Br3F2O — CID 106265752
2-(3-bromo-2,6-difluorophenyl)-1-(3,4-dibromophenyl)ethanol (PubChem CID 106265752) has the molecular formula C14H9Br3F2O and a molecular weight of 470.93 g/mol. Its IUPAC name is 2-(3-bromo-2,6-difluorophenyl)-1-(3,4-dibromophenyl)ethanol.
| Compound Name | 2-(3-bromo-2,6-difluorophenyl)-1-(3,4-dibromophenyl)ethanol |
|---|---|
| PubChem CID | 106265752 |
| Molecular Formula | C14H9Br3F2O |
| Molecular Weight | 470.93 g/mol |
| Exact Mass | 467.82 |
| IUPAC Name | 2-(3-bromo-2,6-difluorophenyl)-1-(3,4-dibromophenyl)ethanol |
| SMILES | OC(Cc1c(F)ccc(Br)c1F)c1ccc(Br)c(Br)c1 |
| InChI | InChI=1S/C14H9Br3F2O/c15-9-2-1-7(5-11(9)17)13(20)6-8-12(18)4-3-10(16)14(8)19/h1-5,13,20H,6H2 |
| InChIKey | HHIBRNHQQRHYLR-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.93 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|