C13H8Br3F2NO — CID 106265600
2-(3-bromo-2,6-difluorophenyl)-1-(3,5-dibromo-2-pyridinyl)ethanol (PubChem CID 106265600) has the molecular formula C13H8Br3F2NO and a molecular weight of 471.92 g/mol. Its IUPAC name is 2-(3-bromo-2,6-difluorophenyl)-1-(3,5-dibromo-2-pyridinyl)ethanol.
| Compound Name | 2-(3-bromo-2,6-difluorophenyl)-1-(3,5-dibromo-2-pyridinyl)ethanol |
|---|---|
| PubChem CID | 106265600 |
| Molecular Formula | C13H8Br3F2NO |
| Molecular Weight | 471.92 g/mol |
| Exact Mass | 468.81 |
| IUPAC Name | 2-(3-bromo-2,6-difluorophenyl)-1-(3,5-dibromo-2-pyridinyl)ethanol |
| SMILES | OC(Cc1c(F)ccc(Br)c1F)c1ncc(Br)cc1Br |
| InChI | InChI=1S/C13H8Br3F2NO/c14-6-3-9(16)13(19-5-6)11(20)4-7-10(17)2-1-8(15)12(7)18/h1-3,5,11,20H,4H2 |
| InChIKey | ORRYUIBXGVJWFZ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.92 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|