C13H13BrF2N2OS — CID 106274492
2-(3-bromo-2,6-difluorophenyl)-1-(4-propan-2-ylthiadiazol-5-yl)ethanol (PubChem CID 106274492) has the molecular formula C13H13BrF2N2OS and a molecular weight of 363.23 g/mol. Its IUPAC name is 2-(3-bromo-2,6-difluorophenyl)-1-(4-propan-2-ylthiadiazol-5-yl)ethanol.
| Compound Name | 2-(3-bromo-2,6-difluorophenyl)-1-(4-propan-2-ylthiadiazol-5-yl)ethanol |
|---|---|
| PubChem CID | 106274492 |
| Molecular Formula | C13H13BrF2N2OS |
| Molecular Weight | 363.23 g/mol |
| Exact Mass | 361.99 |
| IUPAC Name | 2-(3-bromo-2,6-difluorophenyl)-1-(4-propan-2-ylthiadiazol-5-yl)ethanol |
| SMILES | CC(C)c1nnsc1C(O)Cc1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C13H13BrF2N2OS/c1-6(2)12-13(20-18-17-12)10(19)5-7-9(15)4-3-8(14)11(7)16/h3-4,6,10,19H,5H2,1-2H3 |
| InChIKey | NWMQMEDLGSYXNA-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.23 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|