C12H11BrF2N2O — CID 114165938
2-(3-bromo-2,6-difluorophenyl)-1-(2-methylpyrazol-3-yl)ethanol (PubChem CID 114165938) has the molecular formula C12H11BrF2N2O and a molecular weight of 317.13 g/mol. Its IUPAC name is 2-(3-bromo-2,6-difluorophenyl)-1-(2-methylpyrazol-3-yl)ethanol.
| Compound Name | 2-(3-bromo-2,6-difluorophenyl)-1-(2-methylpyrazol-3-yl)ethanol |
|---|---|
| PubChem CID | 114165938 |
| Molecular Formula | C12H11BrF2N2O |
| Molecular Weight | 317.13 g/mol |
| Exact Mass | 316.00 |
| IUPAC Name | 2-(3-bromo-2,6-difluorophenyl)-1-(2-methylpyrazol-3-yl)ethanol |
| SMILES | Cn1nccc1C(O)Cc1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C12H11BrF2N2O/c1-17-10(4-5-16-17)11(18)6-7-9(14)3-2-8(13)12(7)15/h2-5,11,18H,6H2,1H3 |
| InChIKey | LSSOYOHRIPZGEN-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.13 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|