C11H13ClF2 — CID 130605234
2-(1-chloro-2,2-difluoropropyl)-1,4-dimethylbenzene (PubChem CID 130605234) has the molecular formula C11H13ClF2 and a molecular weight of 218.67 g/mol. Its IUPAC name is 2-(1-chloro-2,2-difluoropropyl)-1,4-dimethylbenzene.
| Compound Name | 2-(1-chloro-2,2-difluoropropyl)-1,4-dimethylbenzene |
|---|---|
| PubChem CID | 130605234 |
| Molecular Formula | C11H13ClF2 |
| Molecular Weight | 218.67 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | 2-(1-chloro-2,2-difluoropropyl)-1,4-dimethylbenzene |
| SMILES | Cc1ccc(C)c(C(Cl)C(C)(F)F)c1 |
| InChI | InChI=1S/C11H13ClF2/c1-7-4-5-8(2)9(6-7)10(12)11(3,13)14/h4-6,10H,1-3H3 |
| InChIKey | RUZGICHATRGMCW-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.67 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|