C10H9Cl2F3 — CID 130758085
1-chloro-2-(1-chloro-2,2-difluoropropyl)-5-fluoro-4-methylbenzene (PubChem CID 130758085) has the molecular formula C10H9Cl2F3 and a molecular weight of 257.08 g/mol. Its IUPAC name is 1-chloro-2-(1-chloro-2,2-difluoropropyl)-5-fluoro-4-methylbenzene.
| Compound Name | 1-chloro-2-(1-chloro-2,2-difluoropropyl)-5-fluoro-4-methylbenzene |
|---|---|
| PubChem CID | 130758085 |
| Molecular Formula | C10H9Cl2F3 |
| Molecular Weight | 257.08 g/mol |
| Exact Mass | 256.00 |
| IUPAC Name | 1-chloro-2-(1-chloro-2,2-difluoropropyl)-5-fluoro-4-methylbenzene |
| SMILES | Cc1cc(C(Cl)C(C)(F)F)c(Cl)cc1F |
| InChI | InChI=1S/C10H9Cl2F3/c1-5-3-6(7(11)4-8(5)13)9(12)10(2,14)15/h3-4,9H,1-2H3 |
| InChIKey | OZFUTTWQZTWDKC-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.08 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|