C12H15Cl2FO2S — CID 81050891
1-chloro-2-(1-chloro-2-methyl-2-methylsulfonylpropyl)-5-fluoro-4-methylbenzene (PubChem CID 81050891) has the molecular formula C12H15Cl2FO2S and a molecular weight of 313.22 g/mol. Its IUPAC name is 1-chloro-2-(1-chloro-2-methyl-2-methylsulfonylpropyl)-5-fluoro-4-methylbenzene.
| Compound Name | 1-chloro-2-(1-chloro-2-methyl-2-methylsulfonylpropyl)-5-fluoro-4-methylbenzene |
|---|---|
| PubChem CID | 81050891 |
| Molecular Formula | C12H15Cl2FO2S |
| Molecular Weight | 313.22 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | 1-chloro-2-(1-chloro-2-methyl-2-methylsulfonylpropyl)-5-fluoro-4-methylbenzene |
| SMILES | Cc1cc(C(Cl)C(C)(C)S(C)(=O)=O)c(Cl)cc1F |
| InChI | InChI=1S/C12H15Cl2FO2S/c1-7-5-8(9(13)6-10(7)15)11(14)12(2,3)18(4,16)17/h5-6,11H,1-4H3 |
| InChIKey | ZWLOVBURCVDGFJ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.22 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|