C11H15ClFN — CID 81045762
1-(2-chloro-4-fluoro-5-methylphenyl)-N-ethylethanamine (PubChem CID 81045762) has the molecular formula C11H15ClFN and a molecular weight of 215.70 g/mol. Its IUPAC name is 1-(2-chloro-4-fluoro-5-methylphenyl)-N-ethylethanamine.
| Compound Name | 1-(2-chloro-4-fluoro-5-methylphenyl)-N-ethylethanamine |
|---|---|
| PubChem CID | 81045762 |
| Molecular Formula | C11H15ClFN |
| Molecular Weight | 215.70 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | 1-(2-chloro-4-fluoro-5-methylphenyl)-N-ethylethanamine |
| SMILES | CCNC(C)c1cc(C)c(F)cc1Cl |
| InChI | InChI=1S/C11H15ClFN/c1-4-14-8(3)9-5-7(2)11(13)6-10(9)12/h5-6,8,14H,4H2,1-3H3 |
| InChIKey | NMUCHHPCSCEPBO-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.70 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |