C17H18BrClFN — CID 104851377
N-[(3-bromo-5-methylphenyl)-(2-chloro-4-fluoro-5-methylphenyl)methyl]ethanamine (PubChem CID 104851377) has the molecular formula C17H18BrClFN and a molecular weight of 370.69 g/mol. Its IUPAC name is N-[(3-bromo-5-methylphenyl)-(2-chloro-4-fluoro-5-methylphenyl)methyl]ethanamine.
| Compound Name | N-[(3-bromo-5-methylphenyl)-(2-chloro-4-fluoro-5-methylphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 104851377 |
| Molecular Formula | C17H18BrClFN |
| Molecular Weight | 370.69 g/mol |
| Exact Mass | 369.03 |
| IUPAC Name | N-[(3-bromo-5-methylphenyl)-(2-chloro-4-fluoro-5-methylphenyl)methyl]ethanamine |
| SMILES | CCNC(c1cc(C)cc(Br)c1)c1cc(C)c(F)cc1Cl |
| InChI | InChI=1S/C17H18BrClFN/c1-4-21-17(12-5-10(2)6-13(18)8-12)14-7-11(3)16(20)9-15(14)19/h5-9,17,21H,4H2,1-3H3 |
| InChIKey | HAXVQWSMXYKXSS-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.69 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |