C17H19BrFN — CID 107130305
N-[(3-bromo-5-methylphenyl)-(3-fluoro-4-methylphenyl)methyl]ethanamine (PubChem CID 107130305) has the molecular formula C17H19BrFN and a molecular weight of 336.25 g/mol. Its IUPAC name is N-[(3-bromo-5-methylphenyl)-(3-fluoro-4-methylphenyl)methyl]ethanamine.
| Compound Name | N-[(3-bromo-5-methylphenyl)-(3-fluoro-4-methylphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 107130305 |
| Molecular Formula | C17H19BrFN |
| Molecular Weight | 336.25 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | N-[(3-bromo-5-methylphenyl)-(3-fluoro-4-methylphenyl)methyl]ethanamine |
| SMILES | CCNC(c1cc(C)cc(Br)c1)c1ccc(C)c(F)c1 |
| InChI | InChI=1S/C17H19BrFN/c1-4-20-17(13-6-5-12(3)16(19)10-13)14-7-11(2)8-15(18)9-14/h5-10,17,20H,4H2,1-3H3 |
| InChIKey | XLJIBTQLXHAMPY-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.25 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |