C14H21ClFNO2S — CID 81045137
1-(2-chloro-4-fluoro-5-methylphenyl)-N-ethyl-2-methyl-2-methylsulfonylpropan-1-amine (PubChem CID 81045137) has the molecular formula C14H21ClFNO2S and a molecular weight of 321.85 g/mol. Its IUPAC name is 1-(2-chloro-4-fluoro-5-methylphenyl)-N-ethyl-2-methyl-2-methylsulfonylpropan-1-amine.
| Compound Name | 1-(2-chloro-4-fluoro-5-methylphenyl)-N-ethyl-2-methyl-2-methylsulfonylpropan-1-amine |
|---|---|
| PubChem CID | 81045137 |
| Molecular Formula | C14H21ClFNO2S |
| Molecular Weight | 321.85 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 1-(2-chloro-4-fluoro-5-methylphenyl)-N-ethyl-2-methyl-2-methylsulfonylpropan-1-amine |
| SMILES | CCNC(c1cc(C)c(F)cc1Cl)C(C)(C)S(C)(=O)=O |
| InChI | InChI=1S/C14H21ClFNO2S/c1-6-17-13(14(3,4)20(5,18)19)10-7-9(2)12(16)8-11(10)15/h7-8,13,17H,6H2,1-5H3 |
| InChIKey | FAKGXRXEFQJGAO-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.85 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |