C11H14ClFO3S — CID 105397615
1-(2-chloro-5-fluorophenyl)-2-methyl-2-methylsulfonylpropan-1-ol (PubChem CID 105397615) has the molecular formula C11H14ClFO3S and a molecular weight of 280.75 g/mol. Its IUPAC name is 1-(2-chloro-5-fluorophenyl)-2-methyl-2-methylsulfonylpropan-1-ol.
| Compound Name | 1-(2-chloro-5-fluorophenyl)-2-methyl-2-methylsulfonylpropan-1-ol |
|---|---|
| PubChem CID | 105397615 |
| Molecular Formula | C11H14ClFO3S |
| Molecular Weight | 280.75 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | 1-(2-chloro-5-fluorophenyl)-2-methyl-2-methylsulfonylpropan-1-ol |
| SMILES | CC(C)(C(O)c1cc(F)ccc1Cl)S(C)(=O)=O |
| InChI | InChI=1S/C11H14ClFO3S/c1-11(2,17(3,15)16)10(14)8-6-7(13)4-5-9(8)12/h4-6,10,14H,1-3H3 |
| InChIKey | VGMFDZHPOFOZLJ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.75 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |