C11H14ClFO2 — CID 103448569
1-(2-chloro-5-fluorophenyl)-2-methylbutane-1,2-diol (PubChem CID 103448569) has the molecular formula C11H14ClFO2 and a molecular weight of 232.68 g/mol. Its IUPAC name is 1-(2-chloro-5-fluorophenyl)-2-methylbutane-1,2-diol.
| Compound Name | 1-(2-chloro-5-fluorophenyl)-2-methylbutane-1,2-diol |
|---|---|
| PubChem CID | 103448569 |
| Molecular Formula | C11H14ClFO2 |
| Molecular Weight | 232.68 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | 1-(2-chloro-5-fluorophenyl)-2-methylbutane-1,2-diol |
| SMILES | CCC(C)(O)C(O)c1cc(F)ccc1Cl |
| InChI | InChI=1S/C11H14ClFO2/c1-3-11(2,15)10(14)8-6-7(13)4-5-9(8)12/h4-6,10,14-15H,3H2,1-2H3 |
| InChIKey | HJAFRCRCRACTLC-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.68 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |