C12H17FO2 — CID 103448709
1-(5-fluoro-2-methylphenyl)-2-methylbutane-1,2-diol (PubChem CID 103448709) has the molecular formula C12H17FO2 and a molecular weight of 212.26 g/mol. Its IUPAC name is 1-(5-fluoro-2-methylphenyl)-2-methylbutane-1,2-diol.
| Compound Name | 1-(5-fluoro-2-methylphenyl)-2-methylbutane-1,2-diol |
|---|---|
| PubChem CID | 103448709 |
| Molecular Formula | C12H17FO2 |
| Molecular Weight | 212.26 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 1-(5-fluoro-2-methylphenyl)-2-methylbutane-1,2-diol |
| SMILES | CCC(C)(O)C(O)c1cc(F)ccc1C |
| InChI | InChI=1S/C12H17FO2/c1-4-12(3,15)11(14)10-7-9(13)6-5-8(10)2/h5-7,11,14-15H,4H2,1-3H3 |
| InChIKey | QDUSWTBSWPLXGH-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.26 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |