About CID 170791965
CID 170791965 (PubChem CID 170791965) has the molecular formula C12H20BFO
and a molecular weight of 210.10 g/mol.
Molecular Properties
| Compound Name | CID 170791965 |
| PubChem CID | 170791965 |
| Molecular Formula | C12H20BFO |
| Molecular Weight | 210.10 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | — |
| SMILES | CC.CC.[B]C(O)c1cc(F)ccc1C |
| InChI | InChI=1S/C8H8BFO.2C2H6/c1-5-2-3-6(10)4-7(5)8(9)11;2*1-2/h2-4,8,11H,1H3;2*1-2H3 |
| InChIKey | GMYZFFIBTCHHNP-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.10 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 170791965 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 170791965?
The IUPAC name of CID 170791965 (CID 170791965) is not available.
What is the SMILES notation for CID 170791965?
The canonical SMILES for CID 170791965 is CC.CC.[B]C(O)c1cc(F)ccc1C.
What is the InChIKey of CID 170791965?
The InChIKey is GMYZFFIBTCHHNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8BFO.2C2H6/c1-5-2-3-6(10)4-7(5)8(9)11;2*1-2/h2-4,8,11H,1H3;2*1-2H3.
What are the key properties of CID 170791965?
CID 170791965 has a molecular weight of 210.10 g/mol, XLogP of 3.35, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 170791965 is sourced from PubChem (CID 170791965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).