C10H14FNO — CID 130864158
(1R,2S)-2-amino-1-(5-fluoro-2-methylphenyl)propan-1-ol (PubChem CID 130864158) has the molecular formula C10H14FNO and a molecular weight of 183.23 g/mol. Its IUPAC name is (1R,2S)-2-amino-1-(5-fluoro-2-methylphenyl)propan-1-ol.
| Compound Name | (1R,2S)-2-amino-1-(5-fluoro-2-methylphenyl)propan-1-ol |
|---|---|
| PubChem CID | 130864158 |
| Molecular Formula | C10H14FNO |
| Molecular Weight | 183.23 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | (1R,2S)-2-amino-1-(5-fluoro-2-methylphenyl)propan-1-ol |
| SMILES | Cc1ccc(F)cc1[C@@H](O)[C@H](C)N |
| InChI | InChI=1S/C10H14FNO/c1-6-3-4-8(11)5-9(6)10(13)7(2)12/h3-5,7,10,13H,12H2,1-2H3/t7-,10-/m0/s1 |
| InChIKey | OOJIBLUWANNKBT-XVKPBYJWSA-N |
| XLogP | 1.51 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.23 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |