C10H10FNO2 — CID 171869759
3-(5-fluoro-2-methylphenyl)-2,3-dihydroxypropanenitrile (PubChem CID 171869759) has the molecular formula C10H10FNO2 and a molecular weight of 195.19 g/mol. Its IUPAC name is 3-(5-fluoro-2-methylphenyl)-2,3-dihydroxypropanenitrile.
| Compound Name | 3-(5-fluoro-2-methylphenyl)-2,3-dihydroxypropanenitrile |
|---|---|
| PubChem CID | 171869759 |
| Molecular Formula | C10H10FNO2 |
| Molecular Weight | 195.19 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | 3-(5-fluoro-2-methylphenyl)-2,3-dihydroxypropanenitrile |
| SMILES | Cc1ccc(F)cc1C(O)C(O)C#N |
| InChI | InChI=1S/C10H10FNO2/c1-6-2-3-7(11)4-8(6)10(14)9(13)5-12/h2-4,9-10,13-14H,1H3 |
| InChIKey | PDPYDDKHHLSRKN-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.19 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|