C10H9ClFNO2 — CID 171870077
3-(5-chloro-2-fluoro-4-methylphenyl)-2,3-dihydroxypropanenitrile (PubChem CID 171870077) has the molecular formula C10H9ClFNO2 and a molecular weight of 229.64 g/mol. Its IUPAC name is 3-(5-chloro-2-fluoro-4-methylphenyl)-2,3-dihydroxypropanenitrile.
| Compound Name | 3-(5-chloro-2-fluoro-4-methylphenyl)-2,3-dihydroxypropanenitrile |
|---|---|
| PubChem CID | 171870077 |
| Molecular Formula | C10H9ClFNO2 |
| Molecular Weight | 229.64 g/mol |
| Exact Mass | 229.03 |
| IUPAC Name | 3-(5-chloro-2-fluoro-4-methylphenyl)-2,3-dihydroxypropanenitrile |
| SMILES | Cc1cc(F)c(C(O)C(O)C#N)cc1Cl |
| InChI | InChI=1S/C10H9ClFNO2/c1-5-2-8(12)6(3-7(5)11)10(15)9(14)4-13/h2-3,9-10,14-15H,1H3 |
| InChIKey | AIQLLSISEAWBTD-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.64 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|